상품명칭 |
3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride |
별명 |
3-(2-Chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride; 3-(o-Chlorophenyl)-5-methyl-4-isoxazolecarbonyl chloride; CMIC Chloride |
분자식 |
C11H7Cl2NO2 |
분자량 |
256.0848 |
InChI |
InChI=1/C11H7Cl2NO2/c1-6-9(11(13)15)10(14-16-6)7-4-2-3-5-8(7)12/h2-5H,1H3 |
cas번호 |
25629-50-9 |
EC번호 |
247-137-4 |
분자 구조 |
|
밀도 |
1.381g/cm3 |
비등점 |
381.7°C at 760 mmHg |
굴절 지수 |
1.574 |
인화점 |
184.6°C |
리스크 규칙 |
R34:Causes burns.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|