Nama produk |
3-(2-Chlorophenyl)-5-methylisoxazole-4-carbonyl chloride |
Sinonim |
3-(2-Chlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride; 3-(o-Chlorophenyl)-5-methyl-4-isoxazolecarbonyl chloride; CMIC Chloride |
MF |
C11H7Cl2NO2 |
Berat Molekul |
256.0848 |
InChI |
InChI=1/C11H7Cl2NO2/c1-6-9(11(13)15)10(14-16-6)7-4-2-3-5-8(7)12/h2-5H,1H3 |
CAS NO |
25629-50-9 |
EINECS |
247-137-4 |
Struktur Molekul |
|
Kepadatan |
1.381g/cm3 |
Titik didih |
381.7°C at 760 mmHg |
Indeks bias |
1.574 |
Titik nyala |
184.6°C |
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|