termék neve |
2-chloro-6-methylpyridine-4-carbonyl chloride |
MF |
C7H5Cl2NO |
Molekulatömeg |
190.0267 |
InChI |
InChI=1/C7H5Cl2NO/c1-4-2-5(7(9)11)3-6(8)10-4/h2-3H,1H3 |
CAS-szám |
26413-58-1 |
Molekuláris szerkezete |
|
Sűrűség |
1.384g/cm3 |
Forráspont |
270.3°C at 760 mmHg |
Törésmutató |
1.558 |
Gyulladáspont |
117.3°C |
Veszély szimbólumok |
C:Corrosive;
|
Kockázatot kódok |
R34:Causes burns.;
|
Biztonsági Leírás |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|