2-chloro-6-methylpyridine-4-carbonyl chloride

שם המוצר	2-chloro-6-methylpyridine-4-carbonyl chloride
מולקולרית פורמולה	C₇H₅Cl₂NO
משקל מולקולרי	190.0267
InChI	InChI=1/C7H5Cl2NO/c1-4-2-5(7(9)11)3-6(8)10-4/h2-3H,1H3
מספר CAS	26413-58-1
מבנה מולקולרי
צפיפות	1.384g/cm³
נקודת רתיחה	270.3°C at 760 mmHg
משקל סגולי	1.558
נקודת הבזק	117.3°C
Hazard סימנים	C:Corrosive;
סיכונים קודי	R34:Causes burns.;
בטיחות תיאור	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;