Ονομασία του προϊόντος |
4'-Hydroxychalcone |
Συνώνυμα |
Benzylidene-(4-hydroxyacetophenone); 1-(4-hydroxyphenyl)-3-phenylprop-2-en-1-one; (2E)-1-(4-hydroxyphenyl)-3-phenylprop-2-en-1-one |
MF |
C15H12O2 |
Μοριακό βάρος |
224.2546 |
InChI |
InChI=1/C15H12O2/c16-14-9-7-13(8-10-14)15(17)11-6-12-4-2-1-3-5-12/h1-11,16H/b11-6+ |
CAS ΟΧΙ |
2657-25-2 |
Μοριακή δομή |
|
Πυκνότητα |
1.191g/cm3 |
Σημείο βρασμού |
419.6°C at 760 mmHg |
Δείκτης διάθλασης |
1.653 |
Σημείο ανάφλεξης |
179.1°C |
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|