اسم المنتج |
4'-Hydroxychalcone |
الاسم المستعار |
Benzylidene-(4-hydroxyacetophenone); 1-(4-hydroxyphenyl)-3-phenylprop-2-en-1-one; (2E)-1-(4-hydroxyphenyl)-3-phenylprop-2-en-1-one |
الصيغة الجزيئية |
C15H12O2 |
الوزن الجزيئي الغرامي |
224.2546 |
InChI |
InChI=1/C15H12O2/c16-14-9-7-13(8-10-14)15(17)11-6-12-4-2-1-3-5-12/h1-11,16H/b11-6+ |
إستراتيجية المساعدة القطرية |
2657-25-2 |
بنية جزيئية |
|
كثافة |
1.191g/cm3 |
نقطة الغليان |
419.6°C at 760 mmHg |
معامل الإنكسار |
1.653 |
نقطة الوميض |
179.1°C |
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|