उत्पाद का नाम |
4-methyl-2-phenyl-2-pentenal |
समानार्थी |
Benzeneacetaldehyde, alpha-(2-methylpropylidene)-; 2-Pentenal, 4-methyl-2-phenyl-; 4-Methyl-2-phenyl-2-pentenal; 4-Methyl-2-phenyl-2-penteral; 4-Methyl-2-phenyl-2-penteral (natural); FEMA No. 3200; alpha-(2-Methylpropylidene)benzeneacetaldehyde; alpha-Isobutylidenebenzeneacetaldehyde; 4-methyl-2-phenylpent-2-enal; (2Z)-4-methyl-2-phenylpent-2-enal; (2E)-4-methyl-2-phenylpent-2-enal |
आणविक फार्मूला |
C12H14O |
आण्विक वजन |
174.239 |
InChI |
InChI=1/C12H14O/c1-10(2)8-12(9-13)11-6-4-3-5-7-11/h3-10H,1-2H3/b12-8- |
कैस रजिस्टी संख्या |
26643-91-4 |
EINECS |
247-869-4 |
आणविक संरचना |
|
घनत्व |
0.962g/cm3 |
उबलने का समय |
295.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.517 |
फ्लैश प्वाइंट |
113.9°C |
खतरे के कोड |
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|