Название продукта |
4-methyl-2-phenyl-2-pentenal |
Синонимы |
Benzeneacetaldehyde, alpha-(2-methylpropylidene)-; 2-Pentenal, 4-methyl-2-phenyl-; 4-Methyl-2-phenyl-2-pentenal; 4-Methyl-2-phenyl-2-penteral; 4-Methyl-2-phenyl-2-penteral (natural); FEMA No. 3200; alpha-(2-Methylpropylidene)benzeneacetaldehyde; alpha-Isobutylidenebenzeneacetaldehyde; 4-methyl-2-phenylpent-2-enal; (2Z)-4-methyl-2-phenylpent-2-enal; (2E)-4-methyl-2-phenylpent-2-enal |
Молекулярная формула |
C12H14O |
Молекулярный вес |
174.239 |
InChI |
InChI=1/C12H14O/c1-10(2)8-12(9-13)11-6-4-3-5-7-11/h3-10H,1-2H3/b12-8- |
Регистрационный номер CAS |
26643-91-4 |
EINECS |
247-869-4 |
Молекулярная структура |
|
Плотность |
0.962g/cm3 |
Точка кипения |
295.1°C at 760 mmHg |
Показатель преломления |
1.517 |
Температура вспышки |
113.9°C |
Риск коды |
R36/38:Irritating to eyes and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|