상품명칭 |
2,5-Dimethyl-1,3,4-thiadiazole |
별명 |
1,3,4-Thiadiazole, 2,5-dimethyl-; 2,5-Dimethylthiadiazole; NSC 93787 |
분자식 |
C4H6N2S |
분자량 |
114.1688 |
InChI |
InChI=1/C4H6N2S/c1-3-5-6-4(2)7-3/h1-2H3 |
cas번호 |
27464-82-0 |
EC번호 |
248-473-4 |
분자 구조 |
|
밀도 |
1.166g/cm3 |
녹는 점 |
62-65℃ |
비등점 |
202.5°C at 760 mmHg |
굴절 지수 |
1.534 |
인화점 |
81.2°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|