produktnavn |
2,5-Dimethyl-1,3,4-thiadiazole |
Synonymer |
1,3,4-Thiadiazole, 2,5-dimethyl-; 2,5-Dimethylthiadiazole; NSC 93787 |
Molekylær Formel |
C4H6N2S |
Molekylvekt |
114.1688 |
InChI |
InChI=1/C4H6N2S/c1-3-5-6-4(2)7-3/h1-2H3 |
CAS-nummer |
27464-82-0 |
EINECS |
248-473-4 |
Molecular Structure |
|
Tetthet |
1.166g/cm3 |
Smeltepunkt |
62-65℃ |
Kokepunkt |
202.5°C at 760 mmHg |
Brytningsindeks |
1.534 |
Flammepunktet |
81.2°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|