product Name |
3,4-(Methylenedioxy)mandelic acid |
Synonyms |
alpha-Hydroxy-1,3-benzodioxole-5-acetic acid; 1,3-Benzodioxole-5-glycollic acid; 1,3-benzodioxol-5-yl(hydroxy)acetic acid; (2S)-1,3-benzodioxol-5-yl(hydroxy)ethanoate |
Molecular Formula |
C9H7O5 |
Molecular Weight |
195.1494 |
InChI |
InChI=1/C9H8O5/c10-8(9(11)12)5-1-2-6-7(3-5)14-4-13-6/h1-3,8,10H,4H2,(H,11,12)/p-1/t8-/m0/s1 |
CAS Registry Number |
27738-46-1 |
EINECS |
248-628-6 |
Molecular Structure |
|
Boiling point |
403.5°C at 760 mmHg |
Flash point |
169.2°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|