상품명칭 |
3,4-(Methylenedioxy)mandelic acid |
별명 |
alpha-Hydroxy-1,3-benzodioxole-5-acetic acid; 1,3-Benzodioxole-5-glycollic acid; 1,3-benzodioxol-5-yl(hydroxy)acetic acid; (2S)-1,3-benzodioxol-5-yl(hydroxy)ethanoate |
분자식 |
C9H7O5 |
분자량 |
195.1494 |
InChI |
InChI=1/C9H8O5/c10-8(9(11)12)5-1-2-6-7(3-5)14-4-13-6/h1-3,8,10H,4H2,(H,11,12)/p-1/t8-/m0/s1 |
cas번호 |
27738-46-1 |
EC번호 |
248-628-6 |
분자 구조 |
|
비등점 |
403.5°C at 760 mmHg |
인화점 |
169.2°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|