product Name |
1,2,4-Trivinylcyclohexane, mixture of isomers |
Synonyms |
cyclohexane-1,2,4-triyltris(ethylene); 1,2,4-Trivinyl cyclohexane = TVCH; 1,2,4-Trivinylcyclohexane; 1,2,4-triethenylcyclohexane |
Molecular Formula |
C12H18 |
Molecular Weight |
162.2713 |
InChI |
InChI=1/C12H18/c1-4-10-7-8-11(5-2)12(6-3)9-10/h4-6,10-12H,1-3,7-9H2 |
CAS Registry Number |
2855-27-8 |
EINECS |
220-668-9 |
Molecular Structure |
|
Density |
0.96g/cm3 |
Boiling point |
198.4°C at 760 mmHg |
Refractive index |
1.628 |
Flash point |
68.9°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|