상품명칭 |
1,2,4-Trivinylcyclohexane, mixture of isomers |
별명 |
cyclohexane-1,2,4-triyltris(ethylene); 1,2,4-Trivinyl cyclohexane = TVCH; 1,2,4-Trivinylcyclohexane; 1,2,4-triethenylcyclohexane |
분자식 |
C12H18 |
분자량 |
162.2713 |
InChI |
InChI=1/C12H18/c1-4-10-7-8-11(5-2)12(6-3)9-10/h4-6,10-12H,1-3,7-9H2 |
cas번호 |
2855-27-8 |
EC번호 |
220-668-9 |
분자 구조 |
|
밀도 |
0.96g/cm3 |
비등점 |
198.4°C at 760 mmHg |
굴절 지수 |
1.628 |
인화점 |
68.9°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|