produktnavn |
1-Benzylpiperidine |
Synonymer |
N-benzylpiperidine; 1-benzylpiperidine hydrochloride (1:1) |
Molekylær Formel |
C12H18ClN |
Molekylvekt |
211.731 |
InChI |
InChI=1/C12H17N.ClH/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h1,3-4,7-8H,2,5-6,9-11H2;1H |
CAS-nummer |
2905-56-8 |
EINECS |
220-809-4 |
Molecular Structure |
|
Kokepunkt |
246.6°C at 760 mmHg |
Flammepunktet |
94°C |
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|