Nazwa produktu: |
1-Benzylpiperidine |
Synonimy |
N-benzylpiperidine; 1-benzylpiperidine hydrochloride (1:1) |
MF |
C12H18ClN |
Masie cząsteczkowej |
211.731 |
InChI |
InChI=1/C12H17N.ClH/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;/h1,3-4,7-8H,2,5-6,9-11H2;1H |
Nr CAS |
2905-56-8 |
EINECS |
220-809-4 |
Struktury molekularnej |
|
Temperatura wrzenia |
246.6°C at 760 mmHg |
Temperatura zapłonu |
94°C |
Kody ryzyka |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Bezpieczeństwo opis |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|