상품명칭 |
1,4-Dichloro-2-iodobenzene |
별명 |
2,5-Dichloroiodobenzene; ethyl 2-(methylsulfanyl)quinoline-1(2H)-carboxylate |
분자식 |
C6H3Cl2I |
분자량 |
272.8985 |
InChI |
InChI=1/C6H3Cl2I/c7-4-1-2-5(8)6(9)3-4/h1-3H |
cas번호 |
29682-41-5 |
EC번호 |
249-774-3 |
분자 구조 |
|
밀도 |
2.015g/cm3 |
녹는 점 |
21-257℃ |
비등점 |
255.5°C at 760 mmHg |
굴절 지수 |
1.642 |
인화점 |
93.9°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|