produktnavn |
1,4-Dichloro-2-iodobenzene |
Synonymer |
2,5-Dichloroiodobenzene; ethyl 2-(methylsulfanyl)quinoline-1(2H)-carboxylate |
Molekylær Formel |
C6H3Cl2I |
Molekylvekt |
272.8985 |
InChI |
InChI=1/C6H3Cl2I/c7-4-1-2-5(8)6(9)3-4/h1-3H |
CAS-nummer |
29682-41-5 |
EINECS |
249-774-3 |
Molecular Structure |
|
Tetthet |
2.015g/cm3 |
Smeltepunkt |
21-257℃ |
Kokepunkt |
255.5°C at 760 mmHg |
Brytningsindeks |
1.642 |
Flammepunktet |
93.9°C |
Hazard symboler |
Xi:Irritant;
|
Risiko Koder |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Sikkerhet Beskrivelse |
S24/25:Avoid contact with skin and eyes.;
|
|