उत्पाद का नाम |
cyclobutyl methyl ketone |
समानार्थी |
Acetylcyclobutane; 1-cyclobutylethanone
; 1-cyclobutylethanone |
आणविक फार्मूला |
C6H10O |
आण्विक वजन |
98.143 |
InChI |
InChI=1/C6H10O/c1-5(7)6-3-2-4-6/h6H,2-4H2,1H3 |
कैस रजिस्टी संख्या |
3019-25-8 |
EINECS |
221-163-6 |
आणविक संरचना |
|
घनत्व |
0.96g/cm3 |
उबलने का समय |
137.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.453 |
फ्लैश प्वाइंट |
32.3°C |
खतरे के कोड |
R10:Flammable.;
|
सुरक्षा विवरण |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|