produktnavn |
cyclobutyl methyl ketone |
Synonymer |
Acetylcyclobutane; 1-cyclobutylethanone
; 1-cyclobutylethanone |
Molekylær Formel |
C6H10O |
Molekylvekt |
98.143 |
InChI |
InChI=1/C6H10O/c1-5(7)6-3-2-4-6/h6H,2-4H2,1H3 |
CAS-nummer |
3019-25-8 |
EINECS |
221-163-6 |
Molecular Structure |
|
Tetthet |
0.96g/cm3 |
Kokepunkt |
137.5°C at 760 mmHg |
Brytningsindeks |
1.453 |
Flammepunktet |
32.3°C |
Risiko Koder |
R10:Flammable.;
|
Sikkerhet Beskrivelse |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|