Produkt-Name |
4,5-dichloro-6-methyl-2-(2-pyridyl)pyrimidine |
Synonyme |
4,5-dichloro-6-methyl-2-pyridin-2-ylpyrimidine |
Molekulare Formel |
C10H7Cl2N3 |
Molecular Weight |
240.0887 |
InChI |
InChI=1/C10H7Cl2N3/c1-6-8(11)9(12)15-10(14-6)7-4-2-3-5-13-7/h2-5H,1H3 |
CAS Registry Number |
306935-55-7 |
Molecular Structure |
|
Dichte |
1.375g/cm3 |
Schmelzpunkt |
132℃ |
Siedepunkt |
270.4°C at 760 mmHg |
Brechungsindex |
1.6 |
Flammpunkt |
143.4°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|