상품명칭 |
4,5-dichloro-6-methyl-2-(2-pyridyl)pyrimidine |
별명 |
4,5-dichloro-6-methyl-2-pyridin-2-ylpyrimidine |
분자식 |
C10H7Cl2N3 |
분자량 |
240.0887 |
InChI |
InChI=1/C10H7Cl2N3/c1-6-8(11)9(12)15-10(14-6)7-4-2-3-5-13-7/h2-5H,1H3 |
cas번호 |
306935-55-7 |
분자 구조 |
|
밀도 |
1.375g/cm3 |
녹는 점 |
132℃ |
비등점 |
270.4°C at 760 mmHg |
굴절 지수 |
1.6 |
인화점 |
143.4°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|