نام محصول |
Pyrido[2,3-b]pyrazine |
مترادف |
1,4,5-Triazanaphthalene; Pyrido(2,3-b)pyrazine; Pyridopyrazine |
میدان مغناطیسی |
C7H5N3 |
وزن مولکولی |
131.1347 |
InChI |
InChI=1/C7H5N3/c1-2-6-7(9-3-1)10-5-4-8-6/h1-5H |
شماره سیایاس |
322-46-3 |
تعداد کمیسیون اروپایی |
206-294-9 |
ساختار مولکولی |
|
تراکم |
1.27g/cm3 |
نقطه ذوب |
139-143℃ |
نقطه غلیان |
253.9°C at 760 mmHg |
ضریب شکست |
1.665 |
نقطه اشتعال |
115.9°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|