상품명칭 |
Pyrido[2,3-b]pyrazine |
별명 |
1,4,5-Triazanaphthalene; Pyrido(2,3-b)pyrazine; Pyridopyrazine |
분자식 |
C7H5N3 |
분자량 |
131.1347 |
InChI |
InChI=1/C7H5N3/c1-2-6-7(9-3-1)10-5-4-8-6/h1-5H |
cas번호 |
322-46-3 |
EC번호 |
206-294-9 |
분자 구조 |
|
밀도 |
1.27g/cm3 |
녹는 점 |
139-143℃ |
비등점 |
253.9°C at 760 mmHg |
굴절 지수 |
1.665 |
인화점 |
115.9°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|