Monoethylpimelate

Nama produk	Monoethylpimelate
Sinonim	Ethyl hydrogen pimelate; Heptanedioic acid monoethyl ester; Monoethyl pimelate; Pimelic acid monoethyl ester; Ethylhydrogenpimelate; Pimelicacidmonoethylester; 7-ethoxy-7-oxoheptanoic acid; Boc-His(Tos)-Merrifield resin
MF	C₉H₁₆O₄
Berat Molekul	188.2209
InChI	InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11)
CAS NO	33018-91-6
EINECS	251-346-6
Struktur Molekul
Kepadatan	1.074g/cm³
Titik didih	288.7°C at 760 mmHg
Indeks bias	1.449
Titik nyala	108°C
Kod Risiko	R36/38:Irritating to eyes and skin.;
Keselamatan Penerangan	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;