Monoethylpimelate

اسم المنتج	Monoethylpimelate
الاسم المستعار	Ethyl hydrogen pimelate; Heptanedioic acid monoethyl ester; Monoethyl pimelate; Pimelic acid monoethyl ester; Ethylhydrogenpimelate; Pimelicacidmonoethylester; 7-ethoxy-7-oxoheptanoic acid; Boc-His(Tos)-Merrifield resin
الصيغة الجزيئية	C₉H₁₆O₄
الوزن الجزيئي الغرامي	188.2209
InChI	InChI=1/C9H16O4/c1-2-13-9(12)7-5-3-4-6-8(10)11/h2-7H2,1H3,(H,10,11)
إستراتيجية المساعدة القطرية	33018-91-6
المفوضية الأوروبية رقم	251-346-6
بنية جزيئية
كثافة	1.074g/cm³
نقطة الغليان	288.7°C at 760 mmHg
معامل الإنكسار	1.449
نقطة الوميض	108°C
خطر المصطلحات	R36/38:Irritating to eyes and skin.;
شروط الأمن	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;