Nama produk |
3,4-Dimethoxyphenyl isothiocyanate |
Sinonim |
3,4-Dimethoxyisothiocyanatobenzene; 4-isothiocyanato-1,2-dimethoxybenzene |
MF |
C9H9NO2S |
Berat Molekul |
195.2383 |
InChI |
InChI=1/C9H9NO2S/c1-11-8-4-3-7(10-6-13)5-9(8)12-2/h3-5H,1-2H3 |
CAS NO |
33904-04-0 |
Struktur Molekul |
|
Kepadatan |
1.12g/cm3 |
Titik lebur |
47-172℃ |
Titik didih |
311°C at 760 mmHg |
Indeks bias |
1.537 |
Titik nyala |
141.9°C |
Simbol bahaya |
Xn:Harmful;
|
Kode Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|