نام محصول |
3,4-Dimethoxyphenyl isothiocyanate |
مترادف |
3,4-Dimethoxyisothiocyanatobenzene; 4-isothiocyanato-1,2-dimethoxybenzene |
میدان مغناطیسی |
C9H9NO2S |
وزن مولکولی |
195.2383 |
InChI |
InChI=1/C9H9NO2S/c1-11-8-4-3-7(10-6-13)5-9(8)12-2/h3-5H,1-2H3 |
شماره سیایاس |
33904-04-0 |
ساختار مولکولی |
|
تراکم |
1.12g/cm3 |
نقطه ذوب |
47-172℃ |
نقطه غلیان |
311°C at 760 mmHg |
ضریب شکست |
1.537 |
نقطه اشتعال |
141.9°C |
خطر نمادها |
Xn:Harmful;
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|