product Name |
2,3,4,6-Tetrafluoropyridine |
Molecular Formula |
C5HF4N |
Molecular Weight |
151.0618 |
InChI |
InChI=1/C5HF4N/c6-2-1-3(7)10-5(9)4(2)8/h1H |
CAS Registry Number |
3512-13-8 |
Molecular Structure |
|
Density |
1.518g/cm3 |
Boiling point |
114.6°C at 760 mmHg |
Refractive index |
1.403 |
Flash point |
23.1°C |
Risk Codes |
R34:Causes burns.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|