Naam product |
2,3,4,6-Tetrafluoropyridine |
MF |
C5HF4N |
Molecuulgewicht |
151.0618 |
InChI |
InChI=1/C5HF4N/c6-2-1-3(7)10-5(9)4(2)8/h1H |
CAS-nummer |
3512-13-8 |
Moleculaire Structuur |
|
Dichtheid |
1.518g/cm3 |
Kookpunt |
114.6°C at 760 mmHg |
Brekingsindex |
1.403 |
Vlampunt |
23.1°C |
Risico-codes |
R34:Causes burns.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|