product Name |
2,1,3-Benzothiadiazole-4-carboxylic acid |
Synonyms |
benzo[c][1,2,5]thiadiazole-4-carboxylic acid |
Molecular Formula |
C7H4N2O2S |
Molecular Weight |
180.1839 |
InChI |
InChI=1/C7H4N2O2S/c10-7(11)4-2-1-3-5-6(4)9-12-8-5/h1-3H,(H,10,11) |
CAS Registry Number |
3529-57-5 |
Molecular Structure |
|
Density |
1.609g/cm3 |
Melting point |
145.5℃ |
Boiling point |
368.748°C at 760 mmHg |
Refractive index |
1.749 |
Flash point |
176.813°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|