Naam product |
2,1,3-Benzothiadiazole-4-carboxylic acid |
Synoniemen |
benzo[c][1,2,5]thiadiazole-4-carboxylic acid |
MF |
C7H4N2O2S |
Molecuulgewicht |
180.1839 |
InChI |
InChI=1/C7H4N2O2S/c10-7(11)4-2-1-3-5-6(4)9-12-8-5/h1-3H,(H,10,11) |
CAS-nummer |
3529-57-5 |
Moleculaire Structuur |
|
Dichtheid |
1.609g/cm3 |
Smeltpunt |
145.5℃ |
Kookpunt |
368.748°C at 760 mmHg |
Brekingsindex |
1.749 |
Vlampunt |
176.813°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|