product Name |
1-Ethyl-3-methyl-4-piperidone |
Synonyms |
1-ethyl-3-methylpiperidin-4-one |
Molecular Formula |
C8H15NO |
Molecular Weight |
141.2108 |
InChI |
InChI=1/C8H15NO/c1-3-9-5-4-8(10)7(2)6-9/h7H,3-6H2,1-2H3 |
CAS Registry Number |
3612-16-6 |
Molecular Structure |
|
Density |
0.931g/cm3 |
Boiling point |
212.3°C at 760 mmHg |
Refractive index |
1.45 |
Flash point |
76.2°C |
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|