שם המוצר |
1-Ethyl-3-methyl-4-piperidone |
נרדפות |
1-ethyl-3-methylpiperidin-4-one |
מולקולרית פורמולה |
C8H15NO |
משקל מולקולרי |
141.2108 |
InChI |
InChI=1/C8H15NO/c1-3-9-5-4-8(10)7(2)6-9/h7H,3-6H2,1-2H3 |
מספר CAS |
3612-16-6 |
מבנה מולקולרי |
|
צפיפות |
0.931g/cm3 |
נקודת רתיחה |
212.3°C at 760 mmHg |
משקל סגולי |
1.45 |
נקודת הבזק |
76.2°C |
סיכונים קודי |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|