उत्पाद का नाम |
5-Methyl-2-furanmethanol |
समानार्थी |
(5-Methyl-2-furyl)methanol; (5-methylfuran-2-yl)methanol |
आणविक फार्मूला |
C6H8O2 |
आण्विक वजन |
112.1265 |
InChI |
InChI=1/C6H8O2/c1-5-2-3-6(4-7)8-5/h2-3,7H,4H2,1H3 |
कैस रजिस्टी संख्या |
3857-25-8 |
आणविक संरचना |
|
घनत्व |
1.095g/cm3 |
उबलने का समय |
178.5°C at 760 mmHg |
अपवर्तक सूचकांक |
1.494 |
फ्लैश प्वाइंट |
61.8°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|