Nazwa produktu: |
5-Methyl-2-furanmethanol |
Synonimy |
(5-Methyl-2-furyl)methanol; (5-methylfuran-2-yl)methanol |
MF |
C6H8O2 |
Masie cząsteczkowej |
112.1265 |
InChI |
InChI=1/C6H8O2/c1-5-2-3-6(4-7)8-5/h2-3,7H,4H2,1H3 |
Nr CAS |
3857-25-8 |
Struktury molekularnej |
|
Gęstość |
1.095g/cm3 |
Temperatura wrzenia |
178.5°C at 760 mmHg |
Współczynnik załamania |
1.494 |
Temperatura zapłonu |
61.8°C |
Symbole zagrożenia |
Xn:Harmful;
|
Kody ryzyka |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Bezpieczeństwo opis |
S36/37:Wear suitable protective clothing and gloves.;
|
|