Nama produk |
4-Hydroxybutyric acid hydrazide |
Sinonim |
4-Hydroxybutanoic hydrazide; 4-hydroxybutanehydrazide |
MF |
C4H10N2O2 |
Berat Molekul |
118.1344 |
InChI |
InChI=1/C4H10N2O2/c5-6-4(8)2-1-3-7/h7H,1-3,5H2,(H,6,8) |
CAS NO |
3879-08-1 |
Struktur Molekul |
|
Kepadatan |
1.161g/cm3 |
Titik lebur |
92-93℃ |
Titik didih |
377.5°C at 760 mmHg |
Indeks bias |
1.487 |
Titik nyala |
182.1°C |
Kode Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|