상품명칭 |
4-Hydroxybutyric acid hydrazide |
별명 |
4-Hydroxybutanoic hydrazide; 4-hydroxybutanehydrazide |
분자식 |
C4H10N2O2 |
분자량 |
118.1344 |
InChI |
InChI=1/C4H10N2O2/c5-6-4(8)2-1-3-7/h7H,1-3,5H2,(H,6,8) |
cas번호 |
3879-08-1 |
분자 구조 |
|
밀도 |
1.161g/cm3 |
녹는 점 |
92-93℃ |
비등점 |
377.5°C at 760 mmHg |
굴절 지수 |
1.487 |
인화점 |
182.1°C |
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|