product Name |
5-Amino-6-chloro-2-picoline |
Synonyms |
3-Amino-2-chloro-6-picoline; 2-chloro-3-amino-6-methylpyridine; 2-chloro-6-methylpyridin-3-amine; 2-Chloro-6-methyl-pyridin-3-ylamine; 3-Amino-2-chloro-6-methylpyridine |
Molecular Formula |
C6H7ClN2 |
Molecular Weight |
142.5862 |
InChI |
InChI=1/C6H7ClN2/c1-4-2-3-5(8)6(7)9-4/h2-3H,8H2,1H3 |
CAS Registry Number |
39745-40-9 |
Molecular Structure |
|
Density |
1.26g/cm3 |
Boiling point |
262.3°C at 760 mmHg |
Refractive index |
1.592 |
Flash point |
112.5°C |
Hazard Symbols |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|