Ονομασία του προϊόντος |
5-Amino-6-chloro-2-picoline |
Συνώνυμα |
3-Amino-2-chloro-6-picoline; 2-chloro-3-amino-6-methylpyridine; 2-chloro-6-methylpyridin-3-amine; 2-Chloro-6-methyl-pyridin-3-ylamine; 3-Amino-2-chloro-6-methylpyridine |
MF |
C6H7ClN2 |
Μοριακό βάρος |
142.5862 |
InChI |
InChI=1/C6H7ClN2/c1-4-2-3-5(8)6(7)9-4/h2-3H,8H2,1H3 |
CAS ΟΧΙ |
39745-40-9 |
Μοριακή δομή |
|
Πυκνότητα |
1.26g/cm3 |
Σημείο βρασμού |
262.3°C at 760 mmHg |
Δείκτης διάθλασης |
1.592 |
Σημείο ανάφλεξης |
112.5°C |
Σύμβολα επικινδυνότητας |
Xi:Irritant;
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|