उत्पाद का नाम |
p-Heptyloxyaniline |
समानार्थी |
4-n-Heptyloxyaniline; 4-(heptyloxy)aniline |
आणविक फार्मूला |
C13H21NO |
आण्विक वजन |
207.3119 |
InChI |
InChI=1/C13H21NO/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10H,2-6,11,14H2,1H3 |
कैस रजिस्टी संख्या |
39905-44-7 |
आणविक संरचना |
|
घनत्व |
0.965g/cm3 |
उबलने का समय |
325.9°C at 760 mmHg |
अपवर्तक सूचकांक |
1.516 |
फ्लैश प्वाइंट |
145°C |
खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|