상품명칭 |
p-Heptyloxyaniline |
별명 |
4-n-Heptyloxyaniline; 4-(heptyloxy)aniline |
분자식 |
C13H21NO |
분자량 |
207.3119 |
InChI |
InChI=1/C13H21NO/c1-2-3-4-5-6-11-15-13-9-7-12(14)8-10-13/h7-10H,2-6,11,14H2,1H3 |
cas번호 |
39905-44-7 |
분자 구조 |
|
밀도 |
0.965g/cm3 |
비등점 |
325.9°C at 760 mmHg |
굴절 지수 |
1.516 |
인화점 |
145°C |
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|