Produkt-Name |
1,2,3-Thiadiazole-4-carboxylic acid |
Synonyme |
4-Carboxy-1,2,3-thiadiazole; 1,2,3-thiadiazole-4-carboxylate |
Molekulare Formel |
C3HN2O2S |
Molecular Weight |
129.1178 |
InChI |
InChI=1/C3H2N2O2S/c6-3(7)2-1-8-5-4-2/h1H,(H,6,7)/p-1 |
CAS Registry Number |
4100-13-4 |
Molecular Structure |
|
Schmelzpunkt |
227-228℃ |
Siedepunkt |
322.3°C at 760 mmHg |
Flammpunkt |
148.7°C |
Gefahrensymbole |
Xi:Irritant;
|
Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|