نام محصول |
1,2,3-Thiadiazole-4-carboxylic acid |
مترادف |
4-Carboxy-1,2,3-thiadiazole; 1,2,3-thiadiazole-4-carboxylate |
میدان مغناطیسی |
C3HN2O2S |
وزن مولکولی |
129.1178 |
InChI |
InChI=1/C3H2N2O2S/c6-3(7)2-1-8-5-4-2/h1H,(H,6,7)/p-1 |
شماره سیایاس |
4100-13-4 |
ساختار مولکولی |
|
نقطه ذوب |
227-228℃ |
نقطه غلیان |
322.3°C at 760 mmHg |
نقطه اشتعال |
148.7°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|