4,4'-Biphenyldiboronic acid

نام محصول	4,4'-Biphenyldiboronic acid
مترادف	biphenyl-4,4'-diyldiboronic acid
میدان مغناطیسی	C₁₂H₁₂B₂O₄
وزن مولکولی	241.8433
InChI	InChI=1/C12H12B2O4/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18/h1-8,15-18H
شماره سیایاس	4151-80-8
ساختار مولکولی
تراکم	1.31g/cm³
نقطه ذوب	300℃ (dec.)
نقطه غلیان	505.9°C at 760 mmHg
ضریب شکست	1.62
نقطه اشتعال	259.7°C
خطر نمادها	Xi:Irritant;
کدهای خطر	R36/37/38:Irritating to eyes, respiratory system and skin.;
توضیحات ایمنی	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;