Naam product |
4,4'-Biphenyldiboronic acid |
Synoniemen |
biphenyl-4,4'-diyldiboronic acid |
MF |
C12H12B2O4 |
Molecuulgewicht |
241.8433 |
InChI |
InChI=1/C12H12B2O4/c15-13(16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)14(17)18/h1-8,15-18H |
CAS-nummer |
4151-80-8 |
Moleculaire Structuur |
|
Dichtheid |
1.31g/cm3 |
Smeltpunt |
300℃ (dec.) |
Kookpunt |
505.9°C at 760 mmHg |
Brekingsindex |
1.62 |
Vlampunt |
259.7°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|