שם המוצר |
1-chloro-3-methoxy-2-propanol |
נרדפות |
3-Chloro-1-methoxy-2-propanol; 1-chloro-3-methoxypropan-2-ol |
מולקולרית פורמולה |
C4H9ClO2 |
משקל מולקולרי |
124.5661 |
InChI |
InChI=1/C4H9ClO2/c1-7-3-4(6)2-5/h4,6H,2-3H2,1H3 |
מספר CAS |
4151-97-7 |
EINECS |
223-982-4 |
מבנה מולקולרי |
|
צפיפות |
1.13g/cm3 |
נקודת רתיחה |
181.6°C at 760 mmHg |
משקל סגולי |
1.433 |
נקודת הבזק |
63.6°C |
סיכונים קודי |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36:Irritating to eyes.;
|
בטיחות תיאור |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|