상품명칭 |
1-chloro-3-methoxy-2-propanol |
별명 |
3-Chloro-1-methoxy-2-propanol; 1-chloro-3-methoxypropan-2-ol |
분자식 |
C4H9ClO2 |
분자량 |
124.5661 |
InChI |
InChI=1/C4H9ClO2/c1-7-3-4(6)2-5/h4,6H,2-3H2,1H3 |
cas번호 |
4151-97-7 |
EC번호 |
223-982-4 |
분자 구조 |
|
밀도 |
1.13g/cm3 |
비등점 |
181.6°C at 760 mmHg |
굴절 지수 |
1.433 |
인화점 |
63.6°C |
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36:Irritating to eyes.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|