Ονομασία του προϊόντος |
N-Ethylmaleamic acid |
Συνώνυμα |
Maleic acid monoethylamide; (2E)-4-(ethylamino)-4-oxobut-2-enoic acid; (2Z)-4-(ethylamino)-4-oxobut-2-enoic acid |
MF |
C6H9NO3 |
Μοριακό βάρος |
143.1406 |
InChI |
InChI=1/C6H9NO3/c1-2-7-5(8)3-4-6(9)10/h3-4H,2H2,1H3,(H,7,8)(H,9,10)/b4-3- |
CAS ΟΧΙ |
4166-67-0 |
EINECS |
224-021-1 |
Μοριακή δομή |
|
Πυκνότητα |
1.175g/cm3 |
Σημείο τήξης |
123-125℃ |
Σημείο βρασμού |
375°C at 760 mmHg |
Δείκτης διάθλασης |
1.488 |
Σημείο ανάφλεξης |
180.6°C |
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|