N-Ethylmaleamic acid

שם המוצר	N-Ethylmaleamic acid
נרדפות	Maleic acid monoethylamide; (2E)-4-(ethylamino)-4-oxobut-2-enoic acid; (2Z)-4-(ethylamino)-4-oxobut-2-enoic acid
מולקולרית פורמולה	C₆H₉NO₃
משקל מולקולרי	143.1406
InChI	InChI=1/C6H9NO3/c1-2-7-5(8)3-4-6(9)10/h3-4H,2H2,1H3,(H,7,8)(H,9,10)/b4-3-
מספר CAS	4166-67-0
EINECS	224-021-1
מבנה מולקולרי
צפיפות	1.175g/cm³
נקודת ההתוך	123-125℃
נקודת רתיחה	375°C at 760 mmHg
משקל סגולי	1.488
נקודת הבזק	180.6°C
סיכונים קודי	R36/37/38:Irritating to eyes, respiratory system and skin.;
בטיחות תיאור	S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.;